C14H20BrFN2 — CID 81437105
1-[1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine (PubChem CID 81437105) has the molecular formula C14H20BrFN2 and a molecular weight of 315.23 g/mol. Its IUPAC name is 1-[1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 81437105 |
| Molecular Formula | C14H20BrFN2 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-[1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(Cc2ccc(Br)c(F)c2)CC1 |
| InChI | InChI=1S/C14H20BrFN2/c1-17-9-11-4-6-18(7-5-11)10-12-2-3-13(15)14(16)8-12/h2-3,8,11,17H,4-7,9-10H2,1H3 |
| InChIKey | OHVWVMJYWZSTJV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |