C12H16BrFN2 — CID 81436670
[1-[(4-bromo-3-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 81436670) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is [1-[(4-bromo-3-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [1-[(4-bromo-3-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 81436670 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | [1-[(4-bromo-3-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(Cc2ccc(Br)c(F)c2)C1 |
| InChI | InChI=1S/C12H16BrFN2/c13-11-2-1-9(5-12(11)14)7-16-4-3-10(6-15)8-16/h1-2,5,10H,3-4,6-8,15H2 |
| InChIKey | WFTHLMIGFVREMP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |