C17H26BrFN2 — CID 62592584
N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62592584) has the molecular formula C17H26BrFN2 and a molecular weight of 357.31 g/mol. Its IUPAC name is N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62592584 |
| Molecular Formula | C17H26BrFN2 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCN(Cc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C17H26BrFN2/c1-17(2,3)20-11-13-6-8-21(9-7-13)12-14-4-5-16(19)15(18)10-14/h4-5,10,13,20H,6-9,11-12H2,1-3H3 |
| InChIKey | FKKAEZDLCBWKPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |