C17H19BrClFN4 — CID 90802730
N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-6-chloropyridazin-3-amine (PubChem CID 90802730) has the molecular formula C17H19BrClFN4 and a molecular weight of 413.72 g/mol. Its IUPAC name is N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-6-chloropyridazin-3-amine.
| Compound Name | N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-6-chloropyridazin-3-amine |
|---|---|
| PubChem CID | 90802730 |
| Molecular Formula | C17H19BrClFN4 |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]-6-chloropyridazin-3-amine |
| SMILES | Fc1ccc(CN2CCC(CNc3ccc(Cl)nn3)CC2)cc1Br |
| InChI | InChI=1S/C17H19BrClFN4/c18-14-9-13(1-2-15(14)20)11-24-7-5-12(6-8-24)10-21-17-4-3-16(19)22-23-17/h1-4,9,12H,5-8,10-11H2,(H,21,23) |
| InChIKey | HUCDVPWSEFKJQQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |