C11H15ClN4O2 — CID 91243111
4-[[(6-chloropyridazin-3-yl)amino]methyl]piperidine-1-carboxylic acid (PubChem CID 91243111) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-[[(6-chloropyridazin-3-yl)amino]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[(6-chloropyridazin-3-yl)amino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91243111 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-[[(6-chloropyridazin-3-yl)amino]methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CNc2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C11H15ClN4O2/c12-9-1-2-10(15-14-9)13-7-8-3-5-16(6-4-8)11(17)18/h1-2,8H,3-7H2,(H,13,15)(H,17,18) |
| InChIKey | RYMJNFHFCQLZAF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |