C9H13ClN4 — CID 131048743
6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridazin-3-amine (PubChem CID 131048743) has the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. Its IUPAC name is 6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridazin-3-amine.
| Compound Name | 6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 131048743 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridazin-3-amine |
| SMILES | CN1CC(CNc2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C9H13ClN4/c1-14-5-7(6-14)4-11-9-3-2-8(10)12-13-9/h2-3,7H,4-6H2,1H3,(H,11,13) |
| InChIKey | WRGVBHNRILJBST-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |