C10H14ClN3 — CID 130783828
6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridin-2-amine (PubChem CID 130783828) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 130783828 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 6-chloro-N-[(1-methylazetidin-3-yl)methyl]pyridin-2-amine |
| SMILES | CN1CC(CNc2cccc(Cl)n2)C1 |
| InChI | InChI=1S/C10H14ClN3/c1-14-6-8(7-14)5-12-10-4-2-3-9(11)13-10/h2-4,8H,5-7H2,1H3,(H,12,13) |
| InChIKey | FLECUPSQYBBKKG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|