C12H20N4 — CID 80647279
6-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2,6-diamine (PubChem CID 80647279) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2,6-diamine.
| Compound Name | 6-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647279 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 6-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2,6-diamine |
| SMILES | CN1CCC(CNc2cccc(N)n2)CC1 |
| InChI | InChI=1S/C12H20N4/c1-16-7-5-10(6-8-16)9-14-12-4-2-3-11(13)15-12/h2-4,10H,5-9H2,1H3,(H3,13,14,15) |
| InChIKey | RVFMIMJSGOCCDL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |