C11H15ClN2O2 — CID 106196975
6-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]pyridin-2-amine (PubChem CID 106196975) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 6-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106196975 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 6-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]pyridin-2-amine |
| SMILES | CC1(C)OCC(CNc2cccc(Cl)n2)O1 |
| InChI | InChI=1S/C11H15ClN2O2/c1-11(2)15-7-8(16-11)6-13-10-5-3-4-9(12)14-10/h3-5,8H,6-7H2,1-2H3,(H,13,14) |
| InChIKey | JAUAOLIFVOMNJD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|