C9H13ClN4 — CID 62663579
N'-(6-chloropyridazin-3-yl)-N-cyclopropylethane-1,2-diamine (PubChem CID 62663579) has the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. Its IUPAC name is N'-(6-chloropyridazin-3-yl)-N-cyclopropylethane-1,2-diamine.
| Compound Name | N'-(6-chloropyridazin-3-yl)-N-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 62663579 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N'-(6-chloropyridazin-3-yl)-N-cyclopropylethane-1,2-diamine |
| SMILES | Clc1ccc(NCCNC2CC2)nn1 |
| InChI | InChI=1S/C9H13ClN4/c10-8-3-4-9(14-13-8)12-6-5-11-7-1-2-7/h3-4,7,11H,1-2,5-6H2,(H,12,14) |
| InChIKey | RRABOOKTNYWSFH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|