C11H19ClN4 — CID 559472
N-(6-chloropyridazin-3-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 559472) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(6-chloropyridazin-3-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 559472 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ccc(Cl)nn1 |
| InChI | InChI=1S/C11H19ClN4/c1-3-16(4-2)9-5-8-13-11-7-6-10(12)14-15-11/h6-7H,3-5,8-9H2,1-2H3,(H,13,15) |
| InChIKey | OVLVQTHVTQIMSL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|