C12H23N5 — CID 80944940
N',N'-diethyl-N-(6-hydrazinyl-2-pyridinyl)propane-1,3-diamine (PubChem CID 80944940) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-hydrazinyl-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(6-hydrazinyl-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 80944940 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | N',N'-diethyl-N-(6-hydrazinyl-2-pyridinyl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1cccc(NN)n1 |
| InChI | InChI=1S/C12H23N5/c1-3-17(4-2)10-6-9-14-11-7-5-8-12(15-11)16-13/h5,7-8H,3-4,6,9-10,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | HPHRHIRGSOJBOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|