C9H16N4O — CID 106847100
4-[(6-hydrazinyl-2-pyridinyl)amino]butan-1-ol (PubChem CID 106847100) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-[(6-hydrazinyl-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 4-[(6-hydrazinyl-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106847100 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-[(6-hydrazinyl-2-pyridinyl)amino]butan-1-ol |
| SMILES | NNc1cccc(NCCCCO)n1 |
| InChI | InChI=1S/C9H16N4O/c10-13-9-5-3-4-8(12-9)11-6-1-2-7-14/h3-5,14H,1-2,6-7,10H2,(H2,11,12,13) |
| InChIKey | IYUHGIUWKAPAIV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|