C10H20N6O — CID 107855025
6-[(2-amino-6-hydrazinylpyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 107855025) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-[(2-amino-6-hydrazinylpyrimidin-4-yl)amino]hexan-1-ol.
| Compound Name | 6-[(2-amino-6-hydrazinylpyrimidin-4-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 107855025 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 6-[(2-amino-6-hydrazinylpyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | NNc1cc(NCCCCCCO)nc(N)n1 |
| InChI | InChI=1S/C10H20N6O/c11-10-14-8(7-9(15-10)16-12)13-5-3-1-2-4-6-17/h7,17H,1-6,12H2,(H4,11,13,14,15,16) |
| InChIKey | OAHBTUPGYDTAKN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|