C11H20N4O2 — CID 114053267
6-[(2-amino-6-methoxypyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 114053267) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-[(2-amino-6-methoxypyrimidin-4-yl)amino]hexan-1-ol.
| Compound Name | 6-[(2-amino-6-methoxypyrimidin-4-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 114053267 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 6-[(2-amino-6-methoxypyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | COc1cc(NCCCCCCO)nc(N)n1 |
| InChI | InChI=1S/C11H20N4O2/c1-17-10-8-9(14-11(12)15-10)13-6-4-2-3-5-7-16/h8,16H,2-7H2,1H3,(H3,12,13,14,15) |
| InChIKey | WZAIWWGULQSMJV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|