C8H13N3O2 — CID 66325251
2-[(6-methoxy-2-methylpyrimidin-4-yl)amino]ethanol (PubChem CID 66325251) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-[(6-methoxy-2-methylpyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[(6-methoxy-2-methylpyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 66325251 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-[(6-methoxy-2-methylpyrimidin-4-yl)amino]ethanol |
| SMILES | COc1cc(NCCO)nc(C)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-6-10-7(9-3-4-12)5-8(11-6)13-2/h5,12H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | MZUQVJNPPPWHPN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |