C11H20N4O — CID 106127472
1-N-(6-methoxy-2-methylpyrimidin-4-yl)pentane-1,4-diamine (PubChem CID 106127472) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-N-(6-methoxy-2-methylpyrimidin-4-yl)pentane-1,4-diamine.
| Compound Name | 1-N-(6-methoxy-2-methylpyrimidin-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 106127472 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-N-(6-methoxy-2-methylpyrimidin-4-yl)pentane-1,4-diamine |
| SMILES | COc1cc(NCCCC(C)N)nc(C)n1 |
| InChI | InChI=1S/C11H20N4O/c1-8(12)5-4-6-13-10-7-11(16-3)15-9(2)14-10/h7-8H,4-6,12H2,1-3H3,(H,13,14,15) |
| InChIKey | PCIDBSUSUCQGGJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|