C15H30N6O — CID 139959880
12-[(4,6-diamino-1,3,5-triazin-2-yl)amino]dodecan-1-ol (PubChem CID 139959880) has the molecular formula C15H30N6O and a molecular weight of 310.45 g/mol. Its IUPAC name is 12-[(4,6-diamino-1,3,5-triazin-2-yl)amino]dodecan-1-ol.
| Compound Name | 12-[(4,6-diamino-1,3,5-triazin-2-yl)amino]dodecan-1-ol |
|---|---|
| PubChem CID | 139959880 |
| Molecular Formula | C15H30N6O |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 12-[(4,6-diamino-1,3,5-triazin-2-yl)amino]dodecan-1-ol |
| SMILES | Nc1nc(N)nc(NCCCCCCCCCCCCO)n1 |
| InChI | InChI=1S/C15H30N6O/c16-13-19-14(17)21-15(20-13)18-11-9-7-5-3-1-2-4-6-8-10-12-22/h22H,1-12H2,(H5,16,17,18,19,20,21) |
| InChIKey | XLHLXUPIOMIXAV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|