C23H46N6 — CID 68586329
2-N,4-N-didecyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 68586329) has the molecular formula C23H46N6 and a molecular weight of 406.66 g/mol. Its IUPAC name is 2-N,4-N-didecyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-didecyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 68586329 |
| Molecular Formula | C23H46N6 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.38 |
| IUPAC Name | 2-N,4-N-didecyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCCCNc1nc(N)nc(NCCCCCCCCCC)n1 |
| InChI | InChI=1S/C23H46N6/c1-3-5-7-9-11-13-15-17-19-25-22-27-21(24)28-23(29-22)26-20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3,(H4,24,25,26,27,28,29) |
| InChIKey | GCPLQKXGZFIDOV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|