C9H14Cl2N4 — CID 87963058
4,6-dichloro-2-N-pentylpyrimidine-2,5-diamine (PubChem CID 87963058) has the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. Its IUPAC name is 4,6-dichloro-2-N-pentylpyrimidine-2,5-diamine.
| Compound Name | 4,6-dichloro-2-N-pentylpyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 87963058 |
| Molecular Formula | C9H14Cl2N4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4,6-dichloro-2-N-pentylpyrimidine-2,5-diamine |
| SMILES | CCCCCNc1nc(Cl)c(N)c(Cl)n1 |
| InChI | InChI=1S/C9H14Cl2N4/c1-2-3-4-5-13-9-14-7(10)6(12)8(11)15-9/h2-5,12H2,1H3,(H,13,14,15) |
| InChIKey | UNQNYFLTXKGVDL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|