C12H26N6 — CID 142941534
2-N-butyl-1,3,5-triazine-2,4,6-triamine;pentane (PubChem CID 142941534) has the molecular formula C12H26N6 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-N-butyl-1,3,5-triazine-2,4,6-triamine;pentane.
| Compound Name | 2-N-butyl-1,3,5-triazine-2,4,6-triamine;pentane |
|---|---|
| PubChem CID | 142941534 |
| Molecular Formula | C12H26N6 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-N-butyl-1,3,5-triazine-2,4,6-triamine;pentane |
| SMILES | CCCCC.CCCCNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H14N6.C5H12/c1-2-3-4-10-7-12-5(8)11-6(9)13-7;1-3-5-4-2/h2-4H2,1H3,(H5,8,9,10,11,12,13);3-5H2,1-2H3 |
| InChIKey | DUTSCBWBVGVZOK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|