C7H15N6+ — CID 146910951
4-N-butyl-2-methyl-1,2,3,5-tetrazin-2-ium-4,6-diamine (PubChem CID 146910951) has the molecular formula C7H15N6+ and a molecular weight of 183.24 g/mol. Its IUPAC name is 4-N-butyl-2-methyl-1,2,3,5-tetrazin-2-ium-4,6-diamine.
| Compound Name | 4-N-butyl-2-methyl-1,2,3,5-tetrazin-2-ium-4,6-diamine |
|---|---|
| PubChem CID | 146910951 |
| Molecular Formula | C7H15N6+ |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 4-N-butyl-2-methyl-1,2,3,5-tetrazin-2-ium-4,6-diamine |
| SMILES | CCCCNc1nc(N)n[n+](C)n1 |
| InChI | InChI=1S/C7H15N6/c1-3-4-5-9-7-10-6(8)11-13(2)12-7/h3-5H2,1-2H3,(H3,8,9,10,11,12)/q+1 |
| InChIKey | HCFKYSXHSRXVAA-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|