C14H20Cl4N8 — CID 139203727
N-butyl-4,6-dichloro-1,3,5-triazin-2-amine (PubChem CID 139203727) has the molecular formula C14H20Cl4N8 and a molecular weight of 442.18 g/mol. Its IUPAC name is N-butyl-4,6-dichloro-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-dichloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 139203727 |
| Molecular Formula | C14H20Cl4N8 |
| Molecular Weight | 442.18 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | N-butyl-4,6-dichloro-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1nc(Cl)nc(Cl)n1.CCCCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/2C7H10Cl2N4/c2*1-2-3-4-10-7-12-5(8)11-6(9)13-7/h2*2-4H2,1H3,(H,10,11,12,13) |
| InChIKey | GXGVOYNYXMPELA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.18 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|