C9H17ClN6O2S — CID 80820182
3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propane-1-sulfonamide (PubChem CID 80820182) has the molecular formula C9H17ClN6O2S and a molecular weight of 308.80 g/mol. Its IUPAC name is 3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 80820182 |
| Molecular Formula | C9H17ClN6O2S |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propane-1-sulfonamide |
| SMILES | CCCNc1nc(Cl)nc(NCCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C9H17ClN6O2S/c1-2-4-12-8-14-7(10)15-9(16-8)13-5-3-6-19(11,17)18/h2-6H2,1H3,(H2,11,17,18)(H2,12,13,14,15,16) |
| InChIKey | VUUWOCBAMKQJBW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|