C13H24ClN5O — CID 106014722
6-chloro-2-N-(4-propan-2-yloxybutyl)-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 106014722) has the molecular formula C13H24ClN5O and a molecular weight of 301.82 g/mol. Its IUPAC name is 6-chloro-2-N-(4-propan-2-yloxybutyl)-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(4-propan-2-yloxybutyl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106014722 |
| Molecular Formula | C13H24ClN5O |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 6-chloro-2-N-(4-propan-2-yloxybutyl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Cl)nc(NCCCCOC(C)C)n1 |
| InChI | InChI=1S/C13H24ClN5O/c1-4-7-15-12-17-11(14)18-13(19-12)16-8-5-6-9-20-10(2)3/h10H,4-9H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | QRNJNQUYVZCAMM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|