C10H18ClN5O — CID 80772028
6-chloro-2-N-(3-methoxypropyl)-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 80772028) has the molecular formula C10H18ClN5O and a molecular weight of 259.74 g/mol. Its IUPAC name is 6-chloro-2-N-(3-methoxypropyl)-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(3-methoxypropyl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80772028 |
| Molecular Formula | C10H18ClN5O |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 6-chloro-2-N-(3-methoxypropyl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Cl)nc(NCCCOC)n1 |
| InChI | InChI=1S/C10H18ClN5O/c1-3-5-12-9-14-8(11)15-10(16-9)13-6-4-7-17-2/h3-7H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | AYUPTYYEGGUTCH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|