C15H28ClN5 — CID 107818966
6-chloro-2-N-(7-methyloctyl)-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 107818966) has the molecular formula C15H28ClN5 and a molecular weight of 313.88 g/mol. Its IUPAC name is 6-chloro-2-N-(7-methyloctyl)-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(7-methyloctyl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 107818966 |
| Molecular Formula | C15H28ClN5 |
| Molecular Weight | 313.88 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 6-chloro-2-N-(7-methyloctyl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Cl)nc(NCCCCCCC(C)C)n1 |
| InChI | InChI=1S/C15H28ClN5/c1-4-10-17-14-19-13(16)20-15(21-14)18-11-8-6-5-7-9-12(2)3/h12H,4-11H2,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | ZBCYYOFSZWRYGF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|