C14H26ClN5 — CID 107818968
6-chloro-4-N-ethyl-2-N-(7-methyloctyl)-1,3,5-triazine-2,4-diamine (PubChem CID 107818968) has the molecular formula C14H26ClN5 and a molecular weight of 299.85 g/mol. Its IUPAC name is 6-chloro-4-N-ethyl-2-N-(7-methyloctyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-ethyl-2-N-(7-methyloctyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 107818968 |
| Molecular Formula | C14H26ClN5 |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 6-chloro-4-N-ethyl-2-N-(7-methyloctyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(NCCCCCCC(C)C)n1 |
| InChI | InChI=1S/C14H26ClN5/c1-4-16-13-18-12(15)19-14(20-13)17-10-8-6-5-7-9-11(2)3/h11H,4-10H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | NDJPSYFBNYTLMC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|