C11H22ClN5 — CID 87719227
butane;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 87719227) has the molecular formula C11H22ClN5 and a molecular weight of 259.78 g/mol. Its IUPAC name is butane;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | butane;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87719227 |
| Molecular Formula | C11H22ClN5 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | butane;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCC.CCNc1nc(Cl)nc(NCC)n1 |
| InChI | InChI=1S/C7H12ClN5.C4H10/c1-3-9-6-11-5(8)12-7(13-6)10-4-2;1-3-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13);3-4H2,1-2H3 |
| InChIKey | ONGDHDOTPSXYMW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |