C21H36Cl3N15 — CID 19377260
6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 19377260) has the molecular formula C21H36Cl3N15 and a molecular weight of 604.98 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19377260 |
| Molecular Formula | C21H36Cl3N15 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(NCC)n1.CCNc1nc(Cl)nc(NCC)n1.CCNc1nc(Cl)nc(NCC)n1 |
| InChI | InChI=1S/3C7H12ClN5/c3*1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3*3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | OOMOMEKGIMQUFR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 188.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |