C7H11ClF3N5 — CID 88700506
6-chloro-4-N-ethyl-2-N-(trifluoromethyl)-1,3,5-triazine-2,4-diamine;methane (PubChem CID 88700506) has the molecular formula C7H11ClF3N5 and a molecular weight of 257.65 g/mol. Its IUPAC name is 6-chloro-4-N-ethyl-2-N-(trifluoromethyl)-1,3,5-triazine-2,4-diamine;methane.
| Compound Name | 6-chloro-4-N-ethyl-2-N-(trifluoromethyl)-1,3,5-triazine-2,4-diamine;methane |
|---|---|
| PubChem CID | 88700506 |
| Molecular Formula | C7H11ClF3N5 |
| Molecular Weight | 257.65 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 6-chloro-4-N-ethyl-2-N-(trifluoromethyl)-1,3,5-triazine-2,4-diamine;methane |
| SMILES | C.CCNc1nc(Cl)nc(NC(F)(F)F)n1 |
| InChI | InChI=1S/C6H7ClF3N5.CH4/c1-2-11-4-12-3(7)13-5(14-4)15-6(8,9)10;/h2H2,1H3,(H2,11,12,13,14,15);1H4 |
| InChIKey | HHRQACALNNVVJY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|