C7H12ClN5 — CID 91927796
6-chloro-2-N,4-N-diethyl-(1,3,5-15N3)1,3,5-triazine-2,4-diamine (PubChem CID 91927796) has the molecular formula C7H12ClN5 and a molecular weight of 204.64 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-diethyl-(1,3,5-15N3)1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-diethyl-(1,3,5-15N3)1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91927796 |
| Molecular Formula | C7H12ClN5 |
| Molecular Weight | 204.64 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-chloro-2-N,4-N-diethyl-(1,3,5-15N3)1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1[15n]c(Cl)[15n]c(NCC)[15n]1 |
| InChI | InChI=1S/C7H12ClN5/c1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13)/i11+1,12+1,13+1 |
| InChIKey | ODCWYMIRDDJXKW-AOBXNIALSA-N |
| XLogP | 1.39 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.64 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |