C6H10ClN7O — CID 13196363
[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]urea (PubChem CID 13196363) has the molecular formula C6H10ClN7O and a molecular weight of 231.65 g/mol. Its IUPAC name is [[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]urea.
| Compound Name | [[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]urea |
|---|---|
| PubChem CID | 13196363 |
| Molecular Formula | C6H10ClN7O |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | [[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]urea |
| SMILES | CCNc1nc(Cl)nc(NNC(N)=O)n1 |
| InChI | InChI=1S/C6H10ClN7O/c1-2-9-5-10-3(7)11-6(12-5)14-13-4(8)15/h2H2,1H3,(H3,8,13,15)(H2,9,10,11,12,14) |
| InChIKey | HOJBGOTZNGAPDN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|