C12H19Cl2N9O — CID 87296700
2-chloroacetamide;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1,3,5-triazine (PubChem CID 87296700) has the molecular formula C12H19Cl2N9O and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-chloroacetamide;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1,3,5-triazine.
| Compound Name | 2-chloroacetamide;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1,3,5-triazine |
|---|---|
| PubChem CID | 87296700 |
| Molecular Formula | C12H19Cl2N9O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-chloroacetamide;6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1,3,5-triazine |
| SMILES | CCNc1nc(Cl)nc(NCC)n1.NC(=O)CCl.c1ncncn1 |
| InChI | InChI=1S/C7H12ClN5.C3H3N3.C2H4ClNO/c1-3-9-6-11-5(8)12-7(13-6)10-4-2;1-4-2-6-3-5-1;3-1-2(4)5/h3-4H2,1-2H3,(H2,9,10,11,12,13);1-3H;1H2,(H2,4,5) |
| InChIKey | DRMDHJXGGZBMCY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|