C14H15Cl3N6O2 — CID 27378837
2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-(3,4-dichlorophenyl)carbamate (PubChem CID 27378837) has the molecular formula C14H15Cl3N6O2 and a molecular weight of 405.67 g/mol. Its IUPAC name is 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-(3,4-dichlorophenyl)carbamate.
| Compound Name | 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 27378837 |
| Molecular Formula | C14H15Cl3N6O2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-(3,4-dichlorophenyl)carbamate |
| SMILES | CCNc1nc(Cl)nc(NCCOC(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H15Cl3N6O2/c1-2-18-12-21-11(17)22-13(23-12)19-5-6-25-14(24)20-8-3-4-9(15)10(16)7-8/h3-4,7H,2,5-6H2,1H3,(H,20,24)(H2,18,19,21,22,23) |
| InChIKey | LZULWHOZBDBTCX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|