C11H13BrClNO2 — CID 103970695
3-bromopropyl N-(3-chloro-4-methylphenyl)carbamate (PubChem CID 103970695) has the molecular formula C11H13BrClNO2 and a molecular weight of 306.59 g/mol. Its IUPAC name is 3-bromopropyl N-(3-chloro-4-methylphenyl)carbamate.
| Compound Name | 3-bromopropyl N-(3-chloro-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 103970695 |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 3-bromopropyl N-(3-chloro-4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCCCBr)cc1Cl |
| InChI | InChI=1S/C11H13BrClNO2/c1-8-3-4-9(7-10(8)13)14-11(15)16-6-2-5-12/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | SCUGDNCUWXVCBW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|