C16H17ClN2O2 — CID 79341773
[4-(2-aminoethyl)phenyl] N-(3-chloro-4-methylphenyl)carbamate (PubChem CID 79341773) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is [4-(2-aminoethyl)phenyl] N-(3-chloro-4-methylphenyl)carbamate.
| Compound Name | [4-(2-aminoethyl)phenyl] N-(3-chloro-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 79341773 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [4-(2-aminoethyl)phenyl] N-(3-chloro-4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)Oc2ccc(CCN)cc2)cc1Cl |
| InChI | InChI=1S/C16H17ClN2O2/c1-11-2-5-13(10-15(11)17)19-16(20)21-14-6-3-12(4-7-14)8-9-18/h2-7,10H,8-9,18H2,1H3,(H,19,20) |
| InChIKey | IYONOLWOGOPKRS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |