About [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate
[4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate (PubChem CID 79337961) has the molecular formula C15H15ClN2O2
and a molecular weight of 290.75 g/mol. Its IUPAC name is [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate.
Molecular Properties
| Compound Name | [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate |
| PubChem CID | 79337961 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate |
| SMILES | NCCc1ccc(OC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H15ClN2O2/c16-13-3-1-2-4-14(13)18-15(19)20-12-7-5-11(6-8-12)9-10-17/h1-8H,9-10,17H2,(H,18,19) |
| InChIKey | ZOUZWVGWCMUSPJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate?
The IUPAC name of [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate (CID 79337961) is [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate.
What is the SMILES notation for [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate?
The canonical SMILES for [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate is NCCc1ccc(OC(=O)Nc2ccccc2Cl)cc1.
What is the InChIKey of [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate?
The InChIKey is ZOUZWVGWCMUSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O2/c16-13-3-1-2-4-14(13)18-15(19)20-12-7-5-11(6-8-12)9-10-17/h1-8H,9-10,17H2,(H,18,19).
What are the key properties of [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate?
[4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate has a molecular weight of 290.75 g/mol, XLogP of 3.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-aminoethyl)phenyl] N-(2-chlorophenyl)carbamate is sourced from PubChem (CID 79337961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).