C10H13ClN2O2 — CID 79336918
2-aminoethyl N-(3-chloro-4-methylphenyl)carbamate (PubChem CID 79336918) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 2-aminoethyl N-(3-chloro-4-methylphenyl)carbamate.
| Compound Name | 2-aminoethyl N-(3-chloro-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 79336918 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-aminoethyl N-(3-chloro-4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCCN)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O2/c1-7-2-3-8(6-9(7)11)13-10(14)15-5-4-12/h2-3,6H,4-5,12H2,1H3,(H,13,14) |
| InChIKey | UEZDGMKSXKSYKH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |