C12H13Cl2NO4 — CID 159240658
2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl propanoate (PubChem CID 159240658) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl propanoate.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl propanoate |
|---|---|
| PubChem CID | 159240658 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl propanoate |
| SMILES | CCC(=O)OCCOC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO4/c1-2-11(16)18-5-6-19-12(17)15-8-3-4-9(13)10(14)7-8/h3-4,7H,2,5-6H2,1H3,(H,15,17) |
| InChIKey | BTVIKUZEYDTESO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|