C14H9Cl4NO2 — CID 27102174
(2,4-dichlorophenyl)methyl N-(3,4-dichlorophenyl)carbamate (PubChem CID 27102174) has the molecular formula C14H9Cl4NO2 and a molecular weight of 365.04 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl N-(3,4-dichlorophenyl)carbamate.
| Compound Name | (2,4-dichlorophenyl)methyl N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 27102174 |
| Molecular Formula | C14H9Cl4NO2 |
| Molecular Weight | 365.04 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | (2,4-dichlorophenyl)methyl N-(3,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl4NO2/c15-9-2-1-8(12(17)5-9)7-21-14(20)19-10-3-4-11(16)13(18)6-10/h1-6H,7H2,(H,19,20) |
| InChIKey | GICDRFMGEWKVSC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.04 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |