C13H7Cl4NO2 — CID 4318743
(3,5-dichlorophenyl) N-(3,4-dichlorophenyl)carbamate (PubChem CID 4318743) has the molecular formula C13H7Cl4NO2 and a molecular weight of 351.02 g/mol. Its IUPAC name is (3,5-dichlorophenyl) N-(3,4-dichlorophenyl)carbamate.
| Compound Name | (3,5-dichlorophenyl) N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 4318743 |
| Molecular Formula | C13H7Cl4NO2 |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | (3,5-dichlorophenyl) N-(3,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H7Cl4NO2/c14-7-3-8(15)5-10(4-7)20-13(19)18-9-1-2-11(16)12(17)6-9/h1-6H,(H,18,19) |
| InChIKey | OEROCOPYDDIGGC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |