C23H15Cl2NO4 — CID 3970988
(2-methyl-4-oxo-3-phenylchromen-7-yl) N-(3,4-dichlorophenyl)carbamate (PubChem CID 3970988) has the molecular formula C23H15Cl2NO4 and a molecular weight of 440.28 g/mol. Its IUPAC name is (2-methyl-4-oxo-3-phenylchromen-7-yl) N-(3,4-dichlorophenyl)carbamate.
| Compound Name | (2-methyl-4-oxo-3-phenylchromen-7-yl) N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 3970988 |
| Molecular Formula | C23H15Cl2NO4 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | (2-methyl-4-oxo-3-phenylchromen-7-yl) N-(3,4-dichlorophenyl)carbamate |
| SMILES | Cc1oc2cc(OC(=O)Nc3ccc(Cl)c(Cl)c3)ccc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H15Cl2NO4/c1-13-21(14-5-3-2-4-6-14)22(27)17-9-8-16(12-20(17)29-13)30-23(28)26-15-7-10-18(24)19(25)11-15/h2-12H,1H3,(H,26,28) |
| InChIKey | VUIWYAFOJDLFMW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |