C27H22ClNO6 — CID 4202898
[3-(4-chlorophenyl)-2-methyl-4-oxochromen-7-yl] 2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 4202898) has the molecular formula C27H22ClNO6 and a molecular weight of 491.93 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-2-methyl-4-oxochromen-7-yl] 2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [3-(4-chlorophenyl)-2-methyl-4-oxochromen-7-yl] 2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 4202898 |
| Molecular Formula | C27H22ClNO6 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [3-(4-chlorophenyl)-2-methyl-4-oxochromen-7-yl] 2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | Cc1oc2cc(OC(=O)C(C)NC(=O)OCc3ccccc3)ccc2c(=O)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClNO6/c1-16(29-27(32)33-15-18-6-4-3-5-7-18)26(31)35-21-12-13-22-23(14-21)34-17(2)24(25(22)30)19-8-10-20(28)11-9-19/h3-14,16H,15H2,1-2H3,(H,29,32) |
| InChIKey | NWJDGQOHMJOLCZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|