C28H25NO6 — CID 3750622
(3-benzyl-4-methyl-2-oxochromen-7-yl) 2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 3750622) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is (3-benzyl-4-methyl-2-oxochromen-7-yl) 2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (3-benzyl-4-methyl-2-oxochromen-7-yl) 2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 3750622 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (3-benzyl-4-methyl-2-oxochromen-7-yl) 2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2cc(OC(=O)C(C)NC(=O)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C28H25NO6/c1-18-23-14-13-22(16-25(23)35-27(31)24(18)15-20-9-5-3-6-10-20)34-26(30)19(2)29-28(32)33-17-21-11-7-4-8-12-21/h3-14,16,19H,15,17H2,1-2H3,(H,29,32) |
| InChIKey | MQACBKGEMNNZBP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|