C26H23NO6 — CID 2921184
(6-oxobenzo[c]chromen-3-yl) 2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 2921184) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is (6-oxobenzo[c]chromen-3-yl) 2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (6-oxobenzo[c]chromen-3-yl) 2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 2921184 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (6-oxobenzo[c]chromen-3-yl) 2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCCC(NC(=O)OCc1ccccc1)C(=O)Oc1ccc2c(c1)oc(=O)c1ccccc12 |
| InChI | InChI=1S/C26H23NO6/c1-2-8-22(27-26(30)31-16-17-9-4-3-5-10-17)25(29)32-18-13-14-20-19-11-6-7-12-21(19)24(28)33-23(20)15-18/h3-7,9-15,22H,2,8,16H2,1H3,(H,27,30) |
| InChIKey | DDWRSVSCGOLCJP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|