C23H20F3NO6 — CID 2295438
[2-oxo-4-(trifluoromethyl)chromen-7-yl] (2S)-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 2295438) has the molecular formula C23H20F3NO6 and a molecular weight of 463.41 g/mol. Its IUPAC name is [2-oxo-4-(trifluoromethyl)chromen-7-yl] (2S)-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | [2-oxo-4-(trifluoromethyl)chromen-7-yl] (2S)-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 2295438 |
| Molecular Formula | C23H20F3NO6 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [2-oxo-4-(trifluoromethyl)chromen-7-yl] (2S)-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCC[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H20F3NO6/c1-2-6-18(27-22(30)31-13-14-7-4-3-5-8-14)21(29)32-15-9-10-16-17(23(24,25)26)12-20(28)33-19(16)11-15/h3-5,7-12,18H,2,6,13H2,1H3,(H,27,30)/t18-/m0/s1 |
| InChIKey | YDLHBFSYBALJRS-SFHVURJKSA-N |
| XLogP | 4.81 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|