C33H23ClF3NO7 — CID 4028987
[3-(4-chlorophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 4028987) has the molecular formula C33H23ClF3NO7 and a molecular weight of 637.99 g/mol. Its IUPAC name is [3-(4-chlorophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [3-(4-chlorophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 4028987 |
| Molecular Formula | C33H23ClF3NO7 |
| Molecular Weight | 637.99 g/mol |
| Exact Mass | 637.11 |
| IUPAC Name | [3-(4-chlorophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Oc1ccc2c(=O)c(Oc3ccc(Cl)cc3)c(C(F)(F)F)oc2c1)OCc1ccccc1 |
| InChI | InChI=1S/C33H23ClF3NO7/c34-22-11-13-23(14-12-22)43-29-28(39)25-16-15-24(18-27(25)45-30(29)33(35,36)37)44-31(40)26(17-20-7-3-1-4-8-20)38-32(41)42-19-21-9-5-2-6-10-21/h1-16,18,26H,17,19H2,(H,38,41) |
| InChIKey | NTQVHFCICZHJBE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.99 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|