C26H18ClF3O7 — CID 4066518
[3-(4-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(4-chlorophenoxy)propanoate (PubChem CID 4066518) has the molecular formula C26H18ClF3O7 and a molecular weight of 534.87 g/mol. Its IUPAC name is [3-(4-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(4-chlorophenoxy)propanoate.
| Compound Name | [3-(4-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 4066518 |
| Molecular Formula | C26H18ClF3O7 |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | [3-(4-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(4-chlorophenoxy)propanoate |
| SMILES | COc1ccc(Oc2c(C(F)(F)F)oc3cc(OC(=O)C(C)Oc4ccc(Cl)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H18ClF3O7/c1-14(34-17-5-3-15(27)4-6-17)25(32)36-19-11-12-20-21(13-19)37-24(26(28,29)30)23(22(20)31)35-18-9-7-16(33-2)8-10-18/h3-14H,1-2H3 |
| InChIKey | UBLULVVCZWMRNX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|