C25H14Cl3F3O5 — CID 5198197
[3-(2-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 5198197) has the molecular formula C25H14Cl3F3O5 and a molecular weight of 557.74 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [3-(2-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 5198197 |
| Molecular Formula | C25H14Cl3F3O5 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | [3-(2-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Oc1ccc2c(=O)c(-c3ccccc3Cl)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C25H14Cl3F3O5/c1-12(34-19-9-6-13(26)10-18(19)28)24(33)35-14-7-8-16-20(11-14)36-23(25(29,30)31)21(22(16)32)15-4-2-3-5-17(15)27/h2-12H,1H3 |
| InChIKey | MIWUMLHITJVWNN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|